|
CAS#: 19672-24-3 Product: Disodium 4,4'-Azobisbenzoate No suppilers available for the product. |
| Name | Disodium 4,4'-Azobisbenzoate |
|---|---|
| Synonyms | Disodium 4-(4-Carboxylatophenyl)Azobenzoate; Disodium 4,4'-Azobisbenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8N2Na2O4 |
| Molecular Weight | 314.21 |
| CAS Registry Number | 19672-24-3 |
| EINECS | 243-219-9 |
| SMILES | C2=C(N=NC1=CC=C(C=C1)C([O-])=O)C=CC(=C2)C([O-])=O.[Na+].[Na+] |
| InChI | 1S/C14H10N2O4.2Na/c17-13(18)9-1-5-11(6-2-9)15-16-12-7-3-10(4-8-12)14(19)20;;/h1-8H,(H,17,18)(H,19,20);;/q;2*+1/p-2 |
| InChIKey | AOUWWAFLSCTHIF-UHFFFAOYSA-L |
| Boiling point | 541.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 281.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Disodium 4,4'-Azobisbenzoate |