|
CAS#: 1971-59-1 Product: 17,17-Dimethyl-18-Norandrosta-4,13-Dien-3-One No suppilers available for the product. |
| Name | 17,17-Dimethyl-18-Norandrosta-4,13-Dien-3-One |
|---|---|
| Synonyms | Nsc39364; 18-Norandrosta-4,13-Dien-3-One, 17,17-Dimethyl-; C14655 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 |
| CAS Registry Number | 1971-59-1 |
| SMILES | [C@H]23[C@@H]([C@@]1(C(=CC(=O)CC1)CC2)C)CCC4=C3CCC4(C)C |
| InChI | 1S/C20H28O/c1-19(2)10-9-16-15-5-4-13-12-14(21)8-11-20(13,3)18(15)7-6-17(16)19/h12,15,18H,4-11H2,1-3H3/t15-,18-,20-/m0/s1 |
| InChIKey | SPKAUGWCKWXQFM-QSFXBCCZSA-N |
| Density | 1.063g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.928°C at 760 mmHg (Cal.) |
| Flash point | 191.464°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17,17-Dimethyl-18-Norandrosta-4,13-Dien-3-One |