| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Glycine derivatives |
|---|---|
| Name | N-{[(1,1-Dioxido-1-Benzothiophen-3-Yl)Methoxy]Carbonyl}Glycine |
| Synonyms | N-(Benzo[ |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11NO6S |
| Molecular Weight | 297.28 |
| CAS Registry Number | 197245-13-9 |
| SMILES | C1=CC=C2C(=C1)C(=CS2(=O)=O)COC(=O)NCC(=O)O |
| InChI | 1S/C12H11NO6S/c14-11(15)5-13-12(16)19-6-8-7-20(17,18)10-4-2-1-3-9(8)10/h1-4,7H,5-6H2,(H,13,16)(H,14,15) |
| InChIKey | VWCUGFUWQVWBHM-UHFFFAOYSA-N |
| Density | 1.473-1.593 (Expl.) |
|---|---|
| 1.5±0.1g/cm3 (Cal.) | |
| Melting point | 161-163°C (Expl.) |
| Boiling point | 619.3±55.0°C at 760 mmHg (Cal.) |
| Flash point | 328.3±31.5°C (Cal.) |
| Refractive index | 1.62 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-{[(1,1-Dioxido-1-Benzothiophen-3-Yl)Methoxy]Carbonyl}Glycine |