|
CAS#: 20115-34-8 Product: 4-Chloro-2-Nitro-1-(4-Nitrophenoxy)Benzene No suppilers available for the product. |
| Name | 4-Chloro-2-Nitro-1-(4-Nitrophenoxy)Benzene |
|---|---|
| Synonyms | Dncde |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7ClN2O5 |
| Molecular Weight | 294.65 |
| CAS Registry Number | 20115-34-8 |
| SMILES | C1=C(C(=CC(=C1)Cl)[N+]([O-])=O)OC2=CC=C(C=C2)[N+]([O-])=O |
| InChI | 1S/C12H7ClN2O5/c13-8-1-6-12(11(7-8)15(18)19)20-10-4-2-9(3-5-10)14(16)17/h1-7H |
| InChIKey | ZJHSNOFKEHUVCI-UHFFFAOYSA-N |
| Density | 1.506g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.614°C at 760 mmHg (Cal.) |
| Flash point | 194.27°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-2-Nitro-1-(4-Nitrophenoxy)Benzene |