|
CAS#: 20295-17-4 Product: 1,4,5,8-Tetrahydro-4a,8alpha-Ethenonaphthalene No suppilers available for the product. |
| Name | 1,4,5,8-Tetrahydro-4a,8alpha-Ethenonaphthalene |
|---|---|
| Synonyms | 4A,8A-Ethenonaphthalene, 1,4,5,8-Tetrahydro-; [4.4.2]Propella-3,8,11-Triene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 |
| CAS Registry Number | 20295-17-4 |
| SMILES | C3C12C(C=C1)(CC=CC2)CC=C3 |
| InChI | 1S/C12H14/c1-2-6-12-8-4-3-7-11(12,5-1)9-10-12/h1-4,9-10H,5-8H2 |
| InChIKey | VGWHURSVJWSFCK-UHFFFAOYSA-N |
| Density | 1.046g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.522°C at 760 mmHg (Cal.) |
| Flash point | 90.627°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4,5,8-Tetrahydro-4a,8alpha-Ethenonaphthalene |