|
CAS#: 20479-58-7 Product: Sorbitol 6-Phosphate No suppilers available for the product. |
| Name | Sorbitol 6-Phosphate |
|---|---|
| Synonyms | 6-O-Phosphono-D-Glucitol; Chebi:17044; D-Glucitol, 6-(Dihydrogen Phosphate) |
| Molecular Structure | ![]() |
| Molecular Formula | C6H15O9P |
| Molecular Weight | 262.15 |
| CAS Registry Number | 20479-58-7 |
| SMILES | [C@@H]([C@@H](CO[P](=O)(O)O)O)([C@@H]([C@@H](O)CO)O)O |
| InChI | 1S/C6H15O9P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h3-11H,1-2H2,(H2,12,13,14)/t3-,4+,5+,6+/m0/s1 |
| InChIKey | GACTWZZMVMUKNG-SLPGGIOYSA-N |
| Density | 1.844g/cm3 (Cal.) |
|---|---|
| Boiling point | 701.394°C at 760 mmHg (Cal.) |
| Flash point | 377.99°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sorbitol 6-Phosphate |