|
CAS#: 20627-31-0 Product: 8,12-Dimethylbenz[a]Anthracene No suppilers available for the product. |
| Name | 8,12-Dimethylbenz[a]Anthracene |
|---|---|
| Synonyms | 5,9-Dimethyl-1,2-Benzanthracene; 8,12-Dimethylbenz(A)Anthracene; Brn 1959352 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 |
| CAS Registry Number | 20627-31-0 |
| SMILES | C2=CC=C1C(=C3C(=CC1=C2C)C=CC4=CC=CC=C34)C |
| InChI | 1S/C20H16/c1-13-6-5-9-17-14(2)20-16(12-19(13)17)11-10-15-7-3-4-8-18(15)20/h3-12H,1-2H3 |
| InChIKey | FBIFSZUQMIZITB-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.461°C at 760 mmHg (Cal.) |
| Flash point | 227.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8,12-Dimethylbenz[a]Anthracene |