| AEchem Scientific Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (630) 364-5106 | |||
![]() |
info@aechemsc.com | |||
| Chemical manufacturer | ||||
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Aspartic acid derivative |
|---|---|
| Name | (2R)-4-(Allyloxy)-2-({[(2-Methyl-2-Propanyl)Oxy]Carbonyl}Amino)-4-Oxobutanoic Acid |
| Synonyms | Boc-Asp(Oall)-Oh; Boc-D-Asp(OAll)-OH |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.28 |
| CAS Registry Number | 207120-58-9 |
| SMILES | O=C(OC(C)(C)C)N[C@@H](C(=O)O)CC(=O)OC\C=C |
| InChI | 1S/C12H19NO6/c1-5-6-18-9(14)7-8(10(15)16)13-11(17)19-12(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,13,17)(H,15,16)/t8-/m1/s1 |
| InChIKey | WZMNSEVEWIDHND-MRVPVSSYSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.555°C at 760 mmHg (Cal.) |
| Flash point | 218.426°C (Cal.) |
| Refractive index | 1.48 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2R)-4-(Allyloxy)-2-({[(2-Methyl-2-Propanyl)Oxy]Carbonyl}Amino)-4-Oxobutanoic Acid |