|
CAS#: 21441-00-9 Product: 6-Chloro-1,4-Dihydro-4,4-Dimethyl-2H-3,1-Benzoxazin-2-One No suppilers available for the product. |
| Name | 6-Chloro-1,4-Dihydro-4,4-Dimethyl-2H-3,1-Benzoxazin-2-One |
|---|---|
| Synonyms | 6-Chloro-1,2-Dihydro-4,4-Dimethyl-4H-3,1-Benzoxazin-2-One; Brn 0644651; 4H-3,1-Benzoxazin-2-One, 1,2-Dihydro-6-Chloro-4,4-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 |
| CAS Registry Number | 21441-00-9 |
| SMILES | C1=C(Cl)C=CC2=C1C(OC(=O)N2)(C)C |
| InChI | 1S/C10H10ClNO2/c1-10(2)7-5-6(11)3-4-8(7)12-9(13)14-10/h3-5H,1-2H3,(H,12,13) |
| InChIKey | SHGXSFRQFGAMKD-UHFFFAOYSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 255.316°C at 760 mmHg (Cal.) |
| Flash point | 108.212°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-1,4-Dihydro-4,4-Dimethyl-2H-3,1-Benzoxazin-2-One |