|
CAS#: 21648-70-4 Product: 2,4-Dimethyl-2,3-diphenyl-1,3,2-oxazasilolidin-5-one No suppilers available for the product. |
| Name | 2,4-Dimethyl-2,3-diphenyl-1,3,2-oxazasilolidin-5-one |
|---|---|
| Synonyms | 2,4-Dimethyl-2,3-diphenyl-1,3,2-oxazasilolidin-5-one # |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17NO2Si |
| Molecular Weight | 283.40 |
| CAS Registry Number | 21648-70-4 |
| SMILES | O=C3O[Si](c1ccccc1)(N(c2ccccc2)C3C)C |
| InChI | 1S/C16H17NO2Si/c1-13-16(18)19-20(2,15-11-7-4-8-12-15)17(13)14-9-5-3-6-10-14/h3-13H,1-2H3 |
| InChIKey | DNDUSOARNKWWBH-UHFFFAOYSA-N |
| Density | 1.166g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.097°C at 760 mmHg (Cal.) |
| Flash point | 161.3°C (Cal.) |
| Refractive index | 1.593 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dimethyl-2,3-diphenyl-1,3,2-oxazasilolidin-5-one |