|
CAS#: 21879-81-2 Product: Rhodosporin No suppilers available for the product. |
| Name | Rhodosporin |
|---|---|
| Synonyms | (5R,6R,7S)-5,6,7,9,10-Pentahydroxy-2-Methoxy-7-Methyl-6,8-Dihydro-5H-Anthracene-1,4-Quinone; 1,2,3,4-Tetrahydro-1-Beta,2-Beta,3-Beta,5,8-Pentahydroxy-6-Methoxy-3-Methylanthraquinone; 1,4-Anthracenedione, 5,6,7,8-Tetrahydro-5,6,7,9,10-Pentahydroxy-2-Methoxy-7-Methyl-, (5S-(5Alpha,6Beta,7Beta))- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O8 |
| Molecular Weight | 336.30 |
| CAS Registry Number | 21879-81-2 |
| SMILES | [C@]1(O)([C@H](O)[C@H](O)C2=C(C1)C(=C3C(=C2O)C(=O)C=C(OC)C3=O)O)C |
| InChI | 1S/C16H16O8/c1-16(23)4-5-8(14(21)15(16)22)13(20)9-6(17)3-7(24-2)12(19)10(9)11(5)18/h3,14-15,18,20-23H,4H2,1-2H3/t14-,15-,16+/m1/s1 |
| InChIKey | ZQNOLGRKZRDRQO-OAGGEKHMSA-N |
| Density | 1.713g/cm3 (Cal.) |
|---|---|
| Boiling point | 606.556°C at 760 mmHg (Cal.) |
| Flash point | 227.032°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Rhodosporin |