Online Database of Chemicals from Around the World
|
CAS#: 219-08-9 Product: 17H-Cyclopenta[a]Phenanthrene No suppilers available for the product. |
| Name | 17H-Cyclopenta[a]Phenanthrene |
|---|---|
| Synonyms | 17H-Cyclopenta(A)Phenanthrene; 4-05-00-02472 (Beilstein Handbook Reference); Brn 1946958 |
| Molecular Structure | ![CAS#: 219-08-9, 17H-Cyclopenta[a]Phenanthrene](/moreStructures/219-08-9.gif) |
| Molecular Formula | C17H12 |
| Molecular Weight | 216.28 |
| CAS Registry Number | 219-08-9 |
| SMILES | C1=CC3=C(C2=C1CC=C2)C=CC4=C3C=CC=C4 |
| InChI | 1S/C17H12/c1-2-6-14-12(4-1)8-10-17-15-7-3-5-13(15)9-11-16(14)17/h1-4,6-11H,5H2 |
| InChIKey | WTBYIGJBYRZQDP-UHFFFAOYSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.102°C at 760 mmHg (Cal.) |
| Flash point | 195.407°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17H-Cyclopenta[a]Phenanthrene |