|
CAS#: 21917-91-9 Product: 2-Methylphenanthro[2,1-d]Thiazole No suppilers available for the product. |
| Name | 2-Methylphenanthro[2,1-d]Thiazole |
|---|---|
| Synonyms | 2-Methylphenanthro(2,1-D)Thiazole; Brn 1576167; Phenanthro(2,1-D)Thiazole, 2-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H11NS |
| Molecular Weight | 249.33 |
| CAS Registry Number | 21917-91-9 |
| SMILES | C2=C3C(=C1SC(=NC1=C2)C)C=CC4=C3C=CC=C4 |
| InChI | 1S/C16H11NS/c1-10-17-15-9-8-13-12-5-3-2-4-11(12)6-7-14(13)16(15)18-10/h2-9H,1H3 |
| InChIKey | ZPYGSEZNEZRJCM-UHFFFAOYSA-N |
| Density | 1.307g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.713°C at 760 mmHg (Cal.) |
| Flash point | 234.947°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylphenanthro[2,1-d]Thiazole |