|
CAS#: 219-25-0 Product: Naphtho[2,1-e][1]Benzothiole No suppilers available for the product. |
| Name | Naphtho[2,1-e][1]Benzothiole |
|---|---|
| Synonyms | Naphtho[2,1-E]Benzothiophene; Brn 4416886; Phenanthro(2,1-B)Thiophene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H10S |
| Molecular Weight | 234.32 |
| CAS Registry Number | 219-25-0 |
| SMILES | C1=CC4=C(C=C1)C3=CC=C2SC=CC2=C3C=C4 |
| InChI | 1S/C16H10S/c1-2-4-12-11(3-1)5-6-14-13(12)7-8-16-15(14)9-10-17-16/h1-10H |
| InChIKey | WYAKNOROQVZSDA-UHFFFAOYSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.716°C at 760 mmHg (Cal.) |
| Flash point | 166.058°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Naphtho[2,1-e][1]Benzothiole |