|
CAS#: 21925-88-2 Product: Tesicam No suppilers available for the product. |
| Name | Tesicam |
|---|---|
| Synonyms | N-(4-Chlorophenyl)-1,3-Diketo-4H-Isoquinoline-4-Carboxamide; Nsc 355083; Tesicam |
| Molecular Structure | ![]() |
| Molecular Formula | C16H11ClN2O3 |
| Molecular Weight | 314.73 |
| CAS Registry Number | 21925-88-2 |
| SMILES | C1=CC=CC3=C1C(C(NC2=CC=C(C=C2)Cl)=O)C(NC3=O)=O |
| InChI | 1S/C16H11ClN2O3/c17-9-5-7-10(8-6-9)18-15(21)13-11-3-1-2-4-12(11)14(20)19-16(13)22/h1-8,13H,(H,18,21)(H,19,20,22) |
| InChIKey | HWCORKBTTGTRDY-UHFFFAOYSA-N |
| Density | 1.458g/cm3 (Cal.) |
|---|---|
| Boiling point | 608.736°C at 760 mmHg (Cal.) |
| Flash point | 321.952°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tesicam |