|
CAS#: 2193-16-0 Product: N-(2-Diethylaminoethyl)-2-Prop-2-Enoxy-4-(Trifluoromethyl)Benzamide Hydrochloride No suppilers available for the product. |
| Name | N-(2-Diethylaminoethyl)-2-Prop-2-Enoxy-4-(Trifluoromethyl)Benzamide Hydrochloride |
|---|---|
| Synonyms | 2-Allyloxy-N-(2-Diethylaminoethyl)-4-(Trifluoromethyl)Benzamide Hydrochloride; 2-(Allyloxy)-N-(2-(Diethylamino)Ethyl)-Alpha,Alpha,Alpha-Trifluoro-P-Toluamide Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C17H24ClF3N2O2 |
| Molecular Weight | 380.84 |
| CAS Registry Number | 2193-16-0 |
| EINECS | 218-590-5 |
| SMILES | [H+].C1=CC(=CC(=C1C(=O)NCCN(CC)CC)OCC=C)C(F)(F)F.[Cl-] |
| InChI | 1S/C17H23F3N2O2.ClH/c1-4-11-24-15-12-13(17(18,19)20)7-8-14(15)16(23)21-9-10-22(5-2)6-3;/h4,7-8,12H,1,5-6,9-11H2,2-3H3,(H,21,23);1H |
| InChIKey | PYBOYPRLHMLIIJ-UHFFFAOYSA-N |
| Boiling point | 414.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 204.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Diethylaminoethyl)-2-Prop-2-Enoxy-4-(Trifluoromethyl)Benzamide Hydrochloride |