|
CAS#: 22606-88-8 Product: 1-Benzyl-2,2,3,3-Tetramethylazetidine No suppilers available for the product. |
| Name | 1-Benzyl-2,2,3,3-Tetramethylazetidine |
|---|---|
| Synonyms | 1-Benzyl-2,2,3,3-tetramethylazetidine # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.32 |
| CAS Registry Number | 22606-88-8 |
| SMILES | c1ccc(cc1)CN2C(C(C2)(C)C)(C)C |
| InChI | 1S/C14H21N/c1-13(2)11-15(14(13,3)4)10-12-8-6-5-7-9-12/h5-9H,10-11H2,1-4H3 |
| InChIKey | VCDXNVKGQWVKQI-UHFFFAOYSA-N |
| Density | 0.936g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.967°C at 760 mmHg (Cal.) |
| Flash point | 93.097°C (Cal.) |
| Refractive index | 1.512 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Benzyl-2,2,3,3-Tetramethylazetidine |