|
CAS#: 22609-97-8 Product: 4-Butoxy-5-Phenyl-2(5H)-Furanone No suppilers available for the product. |
| Name | 4-Butoxy-5-Phenyl-2(5H)-Furanone |
|---|---|
| Synonyms | 4-Butoxy-5-phenyl-2(5H)-furanone # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.27 |
| CAS Registry Number | 22609-97-8 |
| SMILES | O=C\1OC(C(/OCCCC)=C/1)c2ccccc2 |
| InChI | 1S/C14H16O3/c1-2-3-9-16-12-10-13(15)17-14(12)11-7-5-4-6-8-11/h4-8,10,14H,2-3,9H2,1H3 |
| InChIKey | WYRXTRWOGJYJBF-UHFFFAOYSA-N |
| Density | 1.127g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.661°C at 760 mmHg (Cal.) |
| Flash point | 176.06°C (Cal.) |
| Refractive index | 1.544 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Butoxy-5-Phenyl-2(5H)-Furanone |