Online Database of Chemicals from Around the World
|
CAS#: 2269-44-5 Product: 3-Dehydroanguidin No suppilers available for the product. |
| Name | 3-Dehydroanguidin |
|---|---|
| Synonyms | Bl-5846; Nsc305217; Spiro(2,5-Methano-1-Benzoxepin-10,2'-Oxirane), Trichothec-9-En-3-One Deriv. |
| Molecular Structure |  |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 |
| CAS Registry Number | 2269-44-5 |
| SMILES | [C@H]23C([C@@H](OC(C)=O)[C@@]([C@@]1(COC(C)=O)CCC(=C[C@H]1O2)C)(C)[C@]34OC4)=O |
| InChI | 1S/C19H24O7/c1-10-5-6-18(8-23-11(2)20)13(7-10)26-16-14(22)15(25-12(3)21)17(18,4)19(16)9-24-19/h7,13,15-16H,5-6,8-9H2,1-4H3/t13-,15-,16-,17-,18-,19-/m1/s1 |
| InChIKey | NHJUGASJCCCIPS-NKOUSSCVSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.742°C at 760 mmHg (Cal.) |
| Flash point | 203.651°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Dehydroanguidin |