|
CAS#: 2279-18-7 Product: 3A,4,5,6,7,7alpha-Hexahydro-5(6)-(2-Propenyloxy)-4,7-Methano-1H-Indene No suppilers available for the product. |
| Name | 3A,4,5,6,7,7alpha-Hexahydro-5(6)-(2-Propenyloxy)-4,7-Methano-1H-Indene |
|---|---|
| Synonyms | 4,7-Methano-1H-Indene, 3A,4,5,6,7,7A-Hexahydro-5-(2-Propenyloxy)-; 5-(Allyloxy)-3A,4,5,6,7,7A-Hexahydro-4,7-Methano-1H-Indene |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 2279-18-7 |
| EINECS | 218-908-2 |
| SMILES | C(OC3C2C1C(CC=C1)C(C2)C3)C=C |
| InChI | 1S/C13H18O/c1-2-6-14-13-8-9-7-12(13)11-5-3-4-10(9)11/h2-3,5,9-13H,1,4,6-8H2 |
| InChIKey | QFRXRJATKANZGZ-UHFFFAOYSA-N |
| Density | 1.029g/cm3 (Cal.) |
|---|---|
| Boiling point | 263.808°C at 760 mmHg (Cal.) |
| Flash point | 107.476°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3A,4,5,6,7,7alpha-Hexahydro-5(6)-(2-Propenyloxy)-4,7-Methano-1H-Indene |