Online Database of Chemicals from Around the World
|
CAS#: 2309-39-9 Product: (3b,20S)-20-(Dimethylamino)-Pregn-5-en-3-ol No suppilers available for the product. |
| Name | (3b,20S)-20-(Dimethylamino)-Pregn-5-en-3-ol |
|---|---|
| Synonyms | C10810; Irehine |
| Molecular Structure |  |
| Molecular Formula | C23H39NO |
| Molecular Weight | 345.57 |
| CAS Registry Number | 2309-39-9 |
| SMILES | [C@]34([C@H]([C@H]1[C@@H]([C@@]2(C(=CC1)C[C@@H](O)CC2)C)CC3)CC[C@@H]4[C@@H](N(C)C)C)C |
| InChI | 1S/C23H39NO/c1-15(24(4)5)19-8-9-20-18-7-6-16-14-17(25)10-12-22(16,2)21(18)11-13-23(19,20)3/h6,15,17-21,25H,7-14H2,1-5H3/t15-,17-,18-,19+,20-,21-,22-,23+/m0/s1 |
| InChIKey | UJGXCOFZMJCRLN-VBFLNORGSA-N |
| Density | 1.039g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.479°C at 760 mmHg (Cal.) |
| Flash point | 185.293°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3b,20S)-20-(Dimethylamino)-Pregn-5-en-3-ol |