Online Database of Chemicals from Around the World
|
CAS#: 2340-57-0 Product: 9-(3-Dimethylaminopropyl)-2-(Trifluoromethyl)Thioxanthen-9-Ol No suppilers available for the product. |
| Name | 9-(3-Dimethylaminopropyl)-2-(Trifluoromethyl)Thioxanthen-9-Ol |
|---|---|
| Synonyms | 9-(3-Dimethylaminopropyl)-2-(Trifluoromethyl)-9-Thioxanthenol; 9-(3-(Dimethylamino)Propyl)-2-(Trifluoromethyl)Thioxanthen-9-Ol |
| Molecular Structure |  |
| Molecular Formula | C19H20F3NOS |
| Molecular Weight | 367.43 |
| CAS Registry Number | 2340-57-0 |
| EINECS | 219-054-3 |
| SMILES | C2=C1C(C3=C(SC1=CC=C2C(F)(F)F)C=CC=C3)(O)CCCN(C)C |
| InChI | 1S/C19H20F3NOS/c1-23(2)11-5-10-18(24)14-6-3-4-7-16(14)25-17-9-8-13(12-15(17)18)19(20,21)22/h3-4,6-9,12,24H,5,10-11H2,1-2H3 |
| InChIKey | QWIVUCLTMDQHOY-UHFFFAOYSA-N |
| Density | 1.272g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.284°C at 760 mmHg (Cal.) |
| Flash point | 214.029°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-(3-Dimethylaminopropyl)-2-(Trifluoromethyl)Thioxanthen-9-Ol |