|
CAS#: 23434-49-3 Product: 2-(Tert-Butylamino)-1,4-Naphthoquinone No suppilers available for the product. |
| Name | 2-(Tert-Butylamino)-1,4-Naphthoquinone |
|---|---|
| Synonyms | 2-(Tert-Butylamino)-1,4-Naphthoquinone; 1,4-Naphthalenedione, 2-[(1,1-Dimethylethyl)Amino]-; 1,4-Naphthoquinone, 2-Tert-Butylamino- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 |
| CAS Registry Number | 23434-49-3 |
| SMILES | C1=CC=CC2=C1C(C=C(C2=O)NC(C)(C)C)=O |
| InChI | 1S/C14H15NO2/c1-14(2,3)15-11-8-12(16)9-6-4-5-7-10(9)13(11)17/h4-8,15H,1-3H3 |
| InChIKey | UHMMBLVNMHQUSM-UHFFFAOYSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.452°C at 760 mmHg (Cal.) |
| Flash point | 139.939°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Tert-Butylamino)-1,4-Naphthoquinone |