Online Database of Chemicals from Around the World
| Name | 1,5-Dimethyl[1]Benzothieno[2,3-g]Isoquinoline |
|---|---|
| Synonyms | 1,5-Dimethylbenzothiopheno[2,3-G]Isoquinoline; 1,5-Dimethyl[1]Benzothieno[2,3-G]Isoquinoline; Aids-126772 |
| Molecular Structure | ![CAS#: 23436-73-9, 1,5-Dimethyl[1]Benzothieno[2,3-g]Isoquinoline](/moreStructures/23436-73-9.gif) |
| Molecular Formula | C17H13NS |
| Molecular Weight | 263.36 |
| CAS Registry Number | 23436-73-9 |
| SMILES | C1=C3C(=C(C2=C1C(=NC=C2)C)C)SC4=CC=CC=C34 |
| InChI | 1S/C17H13NS/c1-10-12-7-8-18-11(2)14(12)9-15-13-5-3-4-6-16(13)19-17(10)15/h3-9H,1-2H3 |
| InChIKey | ZCVWAHUQQFAANM-UHFFFAOYSA-N |
| Density | 1.272g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.098°C at 760 mmHg (Cal.) |
| Flash point | 230.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Dimethyl[1]Benzothieno[2,3-g]Isoquinoline |
