|
CAS#: 2355-59-1 Product: (5a,11b,16a)-9-Fluoro-11,21-dihydroxy-16,17-[(1-methylethylidene)bis(oxy)]-Pregnane-3,20-dione No suppilers available for the product. |
| Name | (5a,11b,16a)-9-Fluoro-11,21-dihydroxy-16,17-[(1-methylethylidene)bis(oxy)]-Pregnane-3,20-dione |
|---|---|
| Synonyms | Drocinonida [Inn-Spanish]; Drocinonide; Drocinonide [Usan:Inn] |
| Molecular Structure | ![]() |
| Molecular Formula | C24H35FO6 |
| Molecular Weight | 438.54 |
| CAS Registry Number | 2355-59-1 (36637-22-6) |
| EINECS | 219-093-6 |
| SMILES | [C@H]23C([C@@]1(OC(O[C@@H]1C2)(C)C)C(=O)CO)(C[C@H](O)[C@@]4(F)C3CCC5C4(CCC(=O)C5)C)C |
| InChI | 1S/C24H35FO6/c1-20(2)30-19-10-16-15-6-5-13-9-14(27)7-8-21(13,3)23(15,25)17(28)11-22(16,4)24(19,31-20)18(29)12-26/h13,15-17,19,26,28H,5-12H2,1-4H3/t13?,15?,16-,17-,19+,21?,22?,23-,24+/m0/s1 |
| InChIKey | GZBONOYGBJSTHF-SGWZXRSCSA-N |
| Density | 1.294g/cm3 (Cal.) |
|---|---|
| Boiling point | 558.661°C at 760 mmHg (Cal.) |
| Flash point | 291.668°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5a,11b,16a)-9-Fluoro-11,21-dihydroxy-16,17-[(1-methylethylidene)bis(oxy)]-Pregnane-3,20-dione |