|
CAS#: 23694-46-4 Product: 1-(2-Chlorobenzyl)-1H-Pyrrole No suppilers available for the product. |
| Name | 1-(2-Chlorobenzyl)-1H-Pyrrole |
|---|---|
| Synonyms | 1-(2-Chlorobenzyl)Pyrrole; 1-(O-Chlorobenzyl)-1H-Pyrrole |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10ClN |
| Molecular Weight | 191.66 |
| CAS Registry Number | 23694-46-4 |
| EINECS | 245-830-6 |
| SMILES | C1=CC=C[N]1CC2=C(Cl)C=CC=C2 |
| InChI | 1S/C11H10ClN/c12-11-6-2-1-5-10(11)9-13-7-3-4-8-13/h1-8H,9H2 |
| InChIKey | HEQHSFOPJKRGFK-UHFFFAOYSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.541°C at 760 mmHg (Cal.) |
| Flash point | 123.467°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chlorobenzyl)-1H-Pyrrole |