|
CAS#: 23922-96-5 Product: 5,6-Dimethoxy-2-Naphthalenamine No suppilers available for the product. |
| Name | 5,6-Dimethoxy-2-Naphthalenamine |
|---|---|
| Synonyms | 5,6-Dimethoxy-1-Naphthalenamine; (5,6-Dimethoxy-1-Naphthyl)Amine; 2-Amino-5,6-Dimethoxynaphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 23922-96-5 |
| SMILES | C1=CC=C(C2=C1C(=C(C=C2)OC)OC)N |
| InChI | 1S/C12H13NO2/c1-14-11-7-6-8-9(12(11)15-2)4-3-5-10(8)13/h3-7H,13H2,1-2H3 |
| InChIKey | OXDJLMVTXLXCHL-UHFFFAOYSA-N |
| Density | 1.169g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.823°C at 760 mmHg (Cal.) |
| Flash point | 190.384°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dimethoxy-2-Naphthalenamine |