|
CAS#: 24342-45-8 Product: alpha-(1-Pyrrolidinylimino)Acetophenone No suppilers available for the product. |
| Name | alpha-(1-Pyrrolidinylimino)Acetophenone |
|---|---|
| Synonyms | (2E)-1-Phenyl-2-Pyrrolidin-1-Ylimino-Ethanone; (2E)-1-Phenyl-2-1-Pyrrolidinyliminoethanone; 2-(1-Pyrrolidinylimino)Acetophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 |
| CAS Registry Number | 24342-45-8 |
| SMILES | C2=C(C(=O)/C=N/N1CCCC1)C=CC=C2 |
| InChI | 1S/C12H14N2O/c15-12(11-6-2-1-3-7-11)10-13-14-8-4-5-9-14/h1-3,6-7,10H,4-5,8-9H2/b13-10+ |
| InChIKey | BHSRBJWYRHNBNG-JLHYYAGUSA-N |
| Density | 1.114g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.394°C at 760 mmHg (Cal.) |
| Flash point | 151.198°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-(1-Pyrrolidinylimino)Acetophenone |