|
CAS#: 24646-67-1 Product: 2-(3-Methylbutyl)Anthraquinone No suppilers available for the product. |
| Name | 2-(3-Methylbutyl)Anthraquinone |
|---|---|
| Synonyms | 2-Isopentylanthracene-9,10-Dione; 2-Isoamyl-9,10-Anthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 |
| CAS Registry Number | 24646-67-1 |
| EINECS | 246-381-9 |
| SMILES | C1=CC2=C(C=C1)C(=O)C3=C(C2=O)C=CC(=C3)CCC(C)C |
| InChI | 1S/C19H18O2/c1-12(2)7-8-13-9-10-16-17(11-13)19(21)15-6-4-3-5-14(15)18(16)20/h3-6,9-12H,7-8H2,1-2H3 |
| InChIKey | CQYMOXYSVSNADQ-UHFFFAOYSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.976°C at 760 mmHg (Cal.) |
| Flash point | 164.509°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Methylbutyl)Anthraquinone |