Online Database of Chemicals from Around the World
| Name | 1,3-Dihydro-2-Benzothiophene 2,2-Dioxide |
|---|---|
| Synonyms | 1,3-Dihydroisobenzothiophene 2,2-Dioxide; Zinc01758065; St5440864 |
| Molecular Structure |  |
| Molecular Formula | C8H8O2S |
| Molecular Weight | 168.21 |
| CAS Registry Number | 2471-91-2 |
| SMILES | C1=CC=CC2=C1C[S](=O)(=O)C2 |
| InChI | 1S/C8H8O2S/c9-11(10)5-7-3-1-2-4-8(7)6-11/h1-4H,5-6H2 |
| InChIKey | RBXWSNGDUIKIQJ-UHFFFAOYSA-N |
| Density | 1.345g/cm3 (Cal.) |
|---|---|
| Melting point | 151-152°C (Expl.) |
| Boiling point | 388.559°C at 760 mmHg (Cal.) |
| Flash point | 259.26°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dihydro-2-Benzothiophene 2,2-Dioxide |
