|
CAS#: 24721-24-2 Product: 3-Nitro-trans-Chalcone No suppilers available for the product. |
| Name | 3-Nitro-trans-Chalcone |
|---|---|
| Synonyms | (E)-3-(3-Nitrophenyl)-1-Phenylprop-2-En-1-One; 3-(3-Nitrophenyl)-1-Phenyl-Prop-2-En-1-One; (E)-3-(3-Nitrophenyl)-1-Phenyl-Prop-2-En-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 |
| CAS Registry Number | 24721-24-2 |
| SMILES | C1=C([N+]([O-])=O)C=CC=C1\C=C\C(=O)C2=CC=CC=C2 |
| InChI | 1S/C15H11NO3/c17-15(13-6-2-1-3-7-13)10-9-12-5-4-8-14(11-12)16(18)19/h1-11H/b10-9+ |
| InChIKey | SMFBODMWKWBFOK-MDZDMXLPSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 145-146°C (Expl.) |
| Boiling point | 418.7±45.0°C at 760 mmHg (Cal.) |
| Flash point | 199.9±21.5°C (Cal.) |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | WARNING: Irritates lungs, eyes, skin |
| IRRITANT | |
| Market Analysis Reports |
| List of Reports Available for 3-Nitro-trans-Chalcone |