|
CAS#: 24887-75-0 Product: Androstane No suppilers available for the product. |
| Name | Androstane |
|---|---|
| Synonyms | Aetioallocholane; Androstane, (5Alpha)- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 |
| CAS Registry Number | 24887-75-0 |
| EINECS | 207-116-2 |
| SMILES | [C@H]23[C@@H]([C@@]1([C@H](CCCC1)CC2)C)CC[C@]4([C@H]3CCC4)C |
| InChI | 1S/C19H32/c1-18-11-5-7-16(18)15-9-8-14-6-3-4-12-19(14,2)17(15)10-13-18/h14-17H,3-13H2,1-2H3/t14-,15+,16+,17+,18+,19+/m1/s1 |
| InChIKey | QZLYKIGBANMMBK-UGCZWRCOSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.0±9.0°C at 760 mmHg (Cal.) |
| Flash point | 145.9±12.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Androstane |