| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Scientific Polymer Products, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (585) 265-0413 | |||
![]() |
custserv@scipoly.com | |||
| Chemical manufacturer | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Classification | Catalysts and additives >> Polymer |
|---|---|
| Name | Ethenylbenzene; 2-methylbuta-1,3-diene |
| Synonyms | Isoprene; Vinylbenzene; Ls-181722; 432415_Aldrich |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 |
| CAS Registry Number | 25038-32-8 |
| SMILES | C1=C(C=CC=C1)C=C.CC(C=C)=C |
| InChI | 1S/C8H8.C5H8/c1-2-8-6-4-3-5-7-8;1-4-5(2)3/h2-7H,1H2;4H,1-2H2,3H3 |
| InChIKey | ROGIWVXWXZRRMZ-UHFFFAOYSA-N |
| Boiling point | 145.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.1°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ethenylbenzene; 2-methylbuta-1,3-diene |