Online Database of Chemicals from Around the World
|
CAS#: 25555-11-7 Product: 4-Methoxy-alpha-(Dimethylhydrazono)Acetophenone No suppilers available for the product. |
| Name | 4-Methoxy-alpha-(Dimethylhydrazono)Acetophenone |
|---|---|
| Synonyms | (2E)-2-(Dimethylhydrazono)-1-(4-Methoxyphenyl)Ethanone; Glyoxal, P-Methoxyphenyl-, Dimethyl Hydrazone; P-Methoxyphenylglyoxal N,N-Dimethylhydrazone |
| Molecular Structure |  |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 |
| CAS Registry Number | 25555-11-7 |
| SMILES | C1=C(C(=O)/C=N/N(C)C)C=CC(=C1)OC |
| InChI | 1S/C11H14N2O2/c1-13(2)12-8-11(14)9-4-6-10(15-3)7-5-9/h4-8H,1-3H3/b12-8+ |
| InChIKey | VFUZELURVABLEH-XYOKQWHBSA-N |
| Density | 1.042g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.072°C at 760 mmHg (Cal.) |
| Flash point | 151.003°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methoxy-alpha-(Dimethylhydrazono)Acetophenone |