|
CAS#: 257-13-6 Product: Benzo[b][1]Benzothiepine No suppilers available for the product. |
| Name | Benzo[b][1]Benzothiepine |
|---|---|
| Synonyms | Dibenzo(B,F)Thiepin; Dibenzo[B,F]Thiepin; Nsc102282 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10S |
| Molecular Weight | 210.29 |
| CAS Registry Number | 257-13-6 |
| SMILES | C1=CC=CC2=C1SC3=C(C=C2)C=CC=C3 |
| InChI | 1S/C14H10S/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)15-13/h1-10H |
| InChIKey | KMAWVRYYKYVCNR-UHFFFAOYSA-N |
| Density | 1.191g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.032°C at 760 mmHg (Cal.) |
| Flash point | 159.082°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo[b][1]Benzothiepine |