|
CAS#: 26070-23-5 Product: Trazitiline No suppilers available for the product. |
| Name | Trazitiline |
|---|---|
| Synonyms | Piperazine, 1-(9,10-Ethanoanthracen-9(10H)-Yl)-4-Methyl-; Sd 1223-01; Trazitiline |
| Molecular Structure | ![]() |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.43 |
| CAS Registry Number | 26070-23-5 |
| SMILES | C1=CC=CC3=C1C4(C2=C(C=CC=C2)C3CC4)N5CCN(C)CC5 |
| InChI | 1S/C21H24N2/c1-22-12-14-23(15-13-22)21-11-10-16(17-6-2-4-8-19(17)21)18-7-3-5-9-20(18)21/h2-9,16H,10-15H2,1H3 |
| InChIKey | MXZCHCNRTUYWKE-UHFFFAOYSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.402°C at 760 mmHg (Cal.) |
| Flash point | 190.179°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trazitiline |