|
CAS#: 26746-38-3 Product: 2,3-Ditert-butylphenol No suppilers available for the product. |
| Name | 2,3-Ditert-butylphenol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 26746-38-3 |
| SMILES | C1=CC=C(C(=C1C(C)(C)C)C(C)(C)C)O |
| InChI | 1S/C14H22O/c1-13(2,3)10-8-7-9-11(15)12(10)14(4,5)6/h7-9,15H,1-6H3 |
| InChIKey | SKDGWNHUETZZCS-UHFFFAOYSA-N |
| Density | 0.933g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.844°C at 760 mmHg (Cal.) |
| Flash point | 129.312°C (Cal.) |
| (1) | Tatsuya Fujii, Syuhei Yamaguchi, Shun Hirota and Hideki Masuda. H-atom abstraction reaction for organic substrates via mononuclear copper(ii)-superoxo species as a model for DβM and PHM, Dalton Trans., 2008, 164. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,3-Ditert-butylphenol |