|
CAS#: 2686-47-7 Product: 3,3-Bis(4-Aminophenyl)Butan-2-One No suppilers available for the product. |
| Name | 3,3-Bis(4-Aminophenyl)Butan-2-One |
|---|---|
| Synonyms | 2-Butanone, 3,3-Bis(4-Aminophenyl)-; Amphenone B; C07616 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 |
| CAS Registry Number | 2686-47-7 |
| SMILES | C1=CC(=CC=C1C(C(C)=O)(C)C2=CC=C(C=C2)N)N |
| InChI | 1S/C16H18N2O/c1-11(19)16(2,12-3-7-14(17)8-4-12)13-5-9-15(18)10-6-13/h3-10H,17-18H2,1-2H3 |
| InChIKey | MKBVGNJXUNEBAL-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.8±45.0°C at 760 mmHg (Cal.) |
| Flash point | 222.8±28.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Bis(4-Aminophenyl)Butan-2-One |