|
CAS#: 27206-30-0 Product: 5,5'-Bi-2,1,3-benzoselenadiazole No suppilers available for the product. |
| Name | 5,5'-Bi-2,1,3-benzoselenadiazole |
|---|---|
| Synonyms | 5-Piaselenol-5-Ylpiaselenole; Nsc21919; Nsc 21919 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6N4Se2 |
| Molecular Weight | 364.13 |
| CAS Registry Number | 27206-30-0 |
| SMILES | [Se]=1=NC2=C(N=1)C=CC(=C2)C4=CC3=C(N=[Se]=N3)C=C4 |
| InChI | 1S/C12H6N4Se2/c1-3-9-11(15-17-13-9)5-7(1)8-2-4-10-12(6-8)16-18-14-10/h1-6H |
| InChIKey | LKPVAMTVZFVTJW-UHFFFAOYSA-N |
| Boiling point | 513.559°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 264.391°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5'-Bi-2,1,3-benzoselenadiazole |