Online Database of Chemicals from Around the World
| Name | 2,2'-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl)Imino]Bisethanol |
|---|---|
| Synonyms | 2,2'-((3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl)Imino)Bisethanol |
| Molecular Structure | ![CAS#: 27607-36-9, 2,2'-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl)Imino]Bisethanol](/moreStructures/27607-36-9.gif) |
| Molecular Formula | C14H14F17NO2 |
| Molecular Weight | 551.24 |
| CAS Registry Number | 27607-36-9 |
| EINECS | 248-562-8 |
| SMILES | C(N(CCO)CCO)CC(C(C(C(C(C(C(F)(F)C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| InChI | 1S/C14H14F17NO2/c15-7(16,1-2-32(3-5-33)4-6-34)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h33-34H,1-6H2 |
| InChIKey | MOUDFVMYURTYQA-UHFFFAOYSA-N |
| Density | 1.553g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.172°C at 760 mmHg (Cal.) |
| Flash point | 152.273°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl)Imino]Bisethanol |
