|
CAS#: 2767-77-3 Product: 4-Methylbenzene-1,3-Disulfonyl Chloride No suppilers available for the product. |
| Name | 4-Methylbenzene-1,3-Disulfonyl Chloride |
|---|---|
| Synonyms | Nsc49753; Toluene-2,4-Disulfonyl Chloride; 4-Methyl-1,3-Benzenedisulfonyl Dichloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6Cl2O4S2 |
| Molecular Weight | 289.15 |
| CAS Registry Number | 2767-77-3 |
| SMILES | C1=CC(=CC(=C1C)[S](=O)(=O)Cl)[S](=O)(=O)Cl |
| InChI | 1S/C7H6Cl2O4S2/c1-5-2-3-6(14(8,10)11)4-7(5)15(9,12)13/h2-4H,1H3 |
| InChIKey | CLMMQDZNOXYEBU-UHFFFAOYSA-N |
| Density | 1.615g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.852°C at 760 mmHg (Cal.) |
| Flash point | 200.462°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methylbenzene-1,3-Disulfonyl Chloride |