|
CAS#: 27694-82-2 Product: 1-Benzyl-3,5-Diallyl-S-Triazine-2,4,6(1H,3H,5H)-Trione No suppilers available for the product. |
| Name | 1-Benzyl-3,5-Diallyl-S-Triazine-2,4,6(1H,3H,5H)-Trione |
|---|---|
| Synonyms | 1,3-Diallyl-5-(Phenylmethyl)-1,3,5-Triazinane-2,4,6-Trione; 1,3-Diallyl-5-(Benzyl)-1,3,5-Triazinane-2,4,6-Trione; S-Triazine-2,4,6(1H,3H,5H)-Trione, 1-Benzyl-3,5-Diallyl-, |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 |
| CAS Registry Number | 27694-82-2 |
| SMILES | C2=C(CN1C(N(C(N(C1=O)CC=C)=O)CC=C)=O)C=CC=C2 |
| InChI | 1S/C16H17N3O3/c1-3-10-17-14(20)18(11-4-2)16(22)19(15(17)21)12-13-8-6-5-7-9-13/h3-9H,1-2,10-12H2 |
| InChIKey | RPZFNZAMUHPNCZ-UHFFFAOYSA-N |
| Density | 1.218g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.792°C at 760 mmHg (Cal.) |
| Flash point | 196.938°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Benzyl-3,5-Diallyl-S-Triazine-2,4,6(1H,3H,5H)-Trione |