| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| ChemBridge Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Vitas-M | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 2,6-Ditert-Butyl-4-(Morpholin-4-Ylmethyl)Phenol |
|---|---|
| Synonyms | 2,6-Ditert-Butyl-4-(Morpholinomethyl)Phenol; Nsc203029; 2,6-Bis(Tert-Butyl)-4-(4-Morpholinylmethyl)Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 |
| CAS Registry Number | 2773-50-4 |
| EINECS | 220-467-6 |
| SMILES | C1=C(C=C(C(C)(C)C)C(=C1C(C)(C)C)O)CN2CCOCC2 |
| InChI | 1S/C19H31NO2/c1-18(2,3)15-11-14(13-20-7-9-22-10-8-20)12-16(17(15)21)19(4,5)6/h11-12,21H,7-10,13H2,1-6H3 |
| InChIKey | KWGUJRCPGGSTKB-UHFFFAOYSA-N |
| Density | 1.023g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.06°C at 760 mmHg (Cal.) |
| Flash point | 173.373°C (Cal.) |
| (1) | Tao Zeng and Wan-Zhong Ren . 2,6-Di-tert-butyl-4-(morpholinomethyl)phenol monohydrate , Acta Cryst (2008). E64, o406Â Â |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,6-Ditert-Butyl-4-(Morpholin-4-Ylmethyl)Phenol |