|
CAS#: 27949-30-0 Product: 2,3',6-Biphenyltriol No suppilers available for the product. |
| Name | 2,3',6-Biphenyltriol |
|---|---|
| Synonyms | 2-(3-Hydroxyphenyl)Resorcinol; (1,1'-Biphenyl)-2,3',6-Triol; 2,3',6-Biphenyltriol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 27949-30-0 |
| EINECS | 248-745-2 |
| SMILES | C1=CC=C(C=C1O)C2=C(O)C=CC=C2O |
| InChI | 1S/C12H10O3/c13-9-4-1-3-8(7-9)12-10(14)5-2-6-11(12)15/h1-7,13-15H |
| InChIKey | MMJVFOMJAGADPT-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.01°C at 760 mmHg (Cal.) |
| Flash point | 245.277°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3',6-Biphenyltriol |