|
CAS#: 28118-49-2 Product: 2-Naphthalene(Thiocarboxylic Acid)S-Phenyl Ester No suppilers available for the product. |
| Name | 2-Naphthalene(Thiocarboxylic Acid)S-Phenyl Ester |
|---|---|
| Synonyms | 2-Naphthalenecarbothioic Acid S-Phenyl Ester; Naphthalene-2-Carbothioic Acid S-Phenyl Ester; 2-Naphthoic Acid, S-Phenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C17H12OS |
| Molecular Weight | 264.34 |
| CAS Registry Number | 28118-49-2 |
| SMILES | C1=C3C(=CC=C1C(=O)SC2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C17H12OS/c18-17(19-16-8-2-1-3-9-16)15-11-10-13-6-4-5-7-14(13)12-15/h1-12H |
| InChIKey | OONFEZOOKHKYQL-UHFFFAOYSA-N |
| Density | 1.249g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.895°C at 760 mmHg (Cal.) |
| Flash point | 183.838°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Naphthalene(Thiocarboxylic Acid)S-Phenyl Ester |