|
CAS#: 2816-98-0 Product: 1-[1-(3,4-Dimethylphenyl)Ethyl]-2,3-Dimethylbenzene No suppilers available for the product. |
| Name | 1-[1-(3,4-Dimethylphenyl)Ethyl]-2,3-Dimethylbenzene |
|---|---|
| Synonyms | 1-[1-(3,4-Dimethylphenyl)ethyl]-2,3-dimethylbenzene # |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 |
| CAS Registry Number | 2816-98-0 |
| SMILES | c1(cccc(c1C)C(c2ccc(c(c2)C)C)C)C |
| InChI | 1S/C18H22/c1-12-9-10-17(11-14(12)3)16(5)18-8-6-7-13(2)15(18)4/h6-11,16H,1-5H3 |
| InChIKey | GAYGTTQJQBOZLS-UHFFFAOYSA-N |
| Density | 0.949g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.367°C at 760 mmHg (Cal.) |
| Flash point | 173.942°C (Cal.) |
| Refractive index | 1.546 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[1-(3,4-Dimethylphenyl)Ethyl]-2,3-Dimethylbenzene |