|
CAS#: 28230-81-1 Product: Neopulchellin No suppilers available for the product. |
| Name | Neopulchellin |
|---|---|
| Synonyms | 6,8-Dihydroxy-5,8A-Dimethyl-1-Methylene-4,5,5A,6,7,8,9,9A-Octahydro-3Ah-Azuleno[7,6-D]Furan-2-One; 5,7-Dihydroxy-4A,8-Dimethyl-3-Methylenedecahydroazuleno[6,5-B]Furan-2(3H)-One; Nsc145915 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 |
| CAS Registry Number | 28230-81-1 |
| SMILES | CC13C(C(O)CC1O)C(CC2OC(C(C2C3)=C)=O)C |
| InChI | 1S/C15H22O4/c1-7-4-11-9(8(2)14(18)19-11)6-15(3)12(17)5-10(16)13(7)15/h7,9-13,16-17H,2,4-6H2,1,3H3 |
| InChIKey | BPUNWVGCTMEMKQ-UHFFFAOYSA-N |
| Density | 1.227g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.814°C at 760 mmHg (Cal.) |
| Flash point | 171.177°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Neopulchellin |