|
CAS#: 28236-80-8 Product: N,N'-Dichloro-N,N'-Dinitroethylenediamine No suppilers available for the product. |
| Name | N,N'-Dichloro-N,N'-Dinitroethylenediamine |
|---|---|
| Synonyms | N-Chloro-N-[2-(Chloro-Nitro-Amino)Ethyl]Nitramide; 1,2-Ethanediamine, N,N'-Dichloro-N,N'-Dinitro-; Ethylenediamine, N,N'-Dichloro-N,N'-Dinitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C2H4Cl2N4O4 |
| Molecular Weight | 218.98 |
| CAS Registry Number | 28236-80-8 |
| SMILES | C(N(Cl)[N+]([O-])=O)CN(Cl)[N+]([O-])=O |
| InChI | 1S/C2H4Cl2N4O4/c3-5(7(9)10)1-2-6(4)8(11)12/h1-2H2 |
| InChIKey | PTIDKBLEDRRYBR-UHFFFAOYSA-N |
| Density | 1.761g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.804°C at 760 mmHg (Cal.) |
| Flash point | 167.17°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N'-Dichloro-N,N'-Dinitroethylenediamine |