| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| MP Biomedicals LLC. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Name | Tri-(4-Methylphenyl)Arsine |
|---|---|
| Synonyms | Arsine, Tri-P-Tolyl-; Arsine, Tris(4-Methylphenyl)-; Nsc1464 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H21As |
| Molecular Weight | 348.32 |
| CAS Registry Number | 2896-10-8 |
| EINECS | 220-776-6 |
| SMILES | C1=CC(=CC=C1C)[As](C2=CC=C(C=C2)C)C3=CC=C(C=C3)C |
| InChI | 1S/C21H21As/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21/h4-15H,1-3H3 |
| InChIKey | YFJORWSFSOXFQR-UHFFFAOYSA-N |
| Boiling point | 411.662°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 200.452°C (Cal.) |
| (1) | Leo Kirsten, Gideon Steyl and Andreas Roodt . trans-Dibromidobis(tri-p-tolylarsine)palladium(II) , Acta Cryst (2009). E65, m1449Â Â |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Tri-(4-Methylphenyl)Arsine |