|
CAS#: 29782-65-8 Product: Gorgosterol No suppilers available for the product. |
| Name | Gorgosterol |
|---|---|
| Synonyms | 17-[1-[2-(1,2-Dimethylpropyl)-2-Methyl-Cyclopropyl]Ethyl]-10,13-Dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Ol; 17-[1-[2-(1,2-Dimethylpropyl)-2-Methylcyclopropyl]Ethyl]-10,13-Dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Ol; Gorgosterol |
| Molecular Structure | ![]() |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.72 |
| CAS Registry Number | 29782-65-8 |
| SMILES | CC34C(C1C(C2(C(=CC1)CC(O)CC2)C)CC3)CCC4C(C5C(C5)(C(C(C)C)C)C)C |
| InChI | 1S/C30H50O/c1-18(2)20(4)30(7)17-27(30)19(3)24-10-11-25-23-9-8-21-16-22(31)12-14-28(21,5)26(23)13-15-29(24,25)6/h8,18-20,22-27,31H,9-17H2,1-7H3 |
| InChIKey | YRPMZHRSQIFCLR-UHFFFAOYSA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.134°C at 760 mmHg (Cal.) |
| Flash point | 222.124°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Gorgosterol |